C24H29N3O — CID 2742051
2-[[4-(3,5-ditert-butylpyrazol-1-yl)phenyl]iminomethyl]phenol (PubChem CID 2742051) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-[[4-(3,5-ditert-butylpyrazol-1-yl)phenyl]iminomethyl]phenol.
| Compound Name | 2-[[4-(3,5-ditert-butylpyrazol-1-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 2742051 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2-[[4-(3,5-ditert-butylpyrazol-1-yl)phenyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)n(-c2ccc(/N=C/c3ccccc3O)cc2)n1 |
| InChI | InChI=1S/C24H29N3O/c1-23(2,3)21-15-22(24(4,5)6)27(26-21)19-13-11-18(12-14-19)25-16-17-9-7-8-10-20(17)28/h7-16,28H,1-6H3/b25-16+ |
| InChIKey | OORYAJPEWOEINB-PCLIKHOPSA-N |
| XLogP | 5.92 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|