C18H22N4O2 — CID 67106963
5-amino-2-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]benzoic acid (PubChem CID 67106963) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-amino-2-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]benzoic acid.
| Compound Name | 5-amino-2-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 67106963 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-amino-2-[4-(4,6-dimethyl-2-pyridinyl)piperazin-1-yl]benzoic acid |
| SMILES | Cc1cc(C)nc(N2CCN(c3ccc(N)cc3C(=O)O)CC2)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-12-9-13(2)20-17(10-12)22-7-5-21(6-8-22)16-4-3-14(19)11-15(16)18(23)24/h3-4,9-11H,5-8,19H2,1-2H3,(H,23,24) |
| InChIKey | BUBXNFDSJMHBKK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|