C25H31N3O4 — CID 67107860
tert-butyl 7-(1-pyridin-4-ylpiperidine-4-carbonyl)oxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 67107860) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is tert-butyl 7-(1-pyridin-4-ylpiperidine-4-carbonyl)oxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 7-(1-pyridin-4-ylpiperidine-4-carbonyl)oxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 67107860 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | tert-butyl 7-(1-pyridin-4-ylpiperidine-4-carbonyl)oxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(OC(=O)C3CCN(c4ccncc4)CC3)cc2C1 |
| InChI | InChI=1S/C25H31N3O4/c1-25(2,3)32-24(30)28-15-8-18-4-5-22(16-20(18)17-28)31-23(29)19-9-13-27(14-10-19)21-6-11-26-12-7-21/h4-7,11-12,16,19H,8-10,13-15,17H2,1-3H3 |
| InChIKey | LLGKSGNAIBAPCB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|