C23H24Cl2N8O3 — CID 67107869
2-N,4-N-bis(3-chlorophenyl)-1,3,5-triazine-2,4,6-triamine;5,5-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 67107869) has the molecular formula C23H24Cl2N8O3 and a molecular weight of 531.40 g/mol. Its IUPAC name is 2-N,4-N-bis(3-chlorophenyl)-1,3,5-triazine-2,4,6-triamine;5,5-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 2-N,4-N-bis(3-chlorophenyl)-1,3,5-triazine-2,4,6-triamine;5,5-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 67107869 |
| Molecular Formula | C23H24Cl2N8O3 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2-N,4-N-bis(3-chlorophenyl)-1,3,5-triazine-2,4,6-triamine;5,5-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)NC1=O.Nc1nc(Nc2cccc(Cl)c2)nc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C15H12Cl2N6.C8H12N2O3/c16-9-3-1-5-11(7-9)19-14-21-13(18)22-15(23-14)20-12-6-2-4-10(17)8-12;1-3-8(4-2)5(11)9-7(13)10-6(8)12/h1-8H,(H4,18,19,20,21,22,23);3-4H2,1-2H3,(H2,9,10,11,12,13) |
| InChIKey | JJJAGSIZOXNQIV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 164.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|