C31H38ClN5O8 — CID 67109573
1-(2-methoxyethoxycarbonyloxy)ethyl 1-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-4-carboxylate (PubChem CID 67109573) has the molecular formula C31H38ClN5O8 and a molecular weight of 644.13 g/mol. Its IUPAC name is 1-(2-methoxyethoxycarbonyloxy)ethyl 1-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-4-carboxylate.
| Compound Name | 1-(2-methoxyethoxycarbonyloxy)ethyl 1-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-4-carboxylate |
|---|---|
| PubChem CID | 67109573 |
| Molecular Formula | C31H38ClN5O8 |
| Molecular Weight | 644.13 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | 1-(2-methoxyethoxycarbonyloxy)ethyl 1-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]-2-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]indole-4-carboxylate |
| SMILES | COCCOC(=O)OC(C)OC(=O)c1cccc2c1cc(C(=O)NC1CCN(C(C)C)CC1)n2CC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C31H38ClN5O8/c1-19(2)36-12-10-22(11-13-36)34-29(39)26-16-24-23(30(40)44-20(3)45-31(41)43-15-14-42-4)6-5-7-25(24)37(26)18-28(38)35-27-9-8-21(32)17-33-27/h5-9,16-17,19-20,22H,10-15,18H2,1-4H3,(H,34,39)(H,33,35,38) |
| InChIKey | NKOMKUFDDYCESY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 150.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.13 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|