C18H12N2 — CID 67110565
1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),10,12,14,16,18-nonaene (PubChem CID 67110565) has the molecular formula C18H12N2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),10,12,14,16,18-nonaene.
| Compound Name | 1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 67110565 |
| Molecular Formula | C18H12N2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1,13-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),10,12,14,16,18-nonaene |
| SMILES | C1=Cc2nc3ccccc3n3c2c(c2ccccc23)C1 |
| InChI | InChI=1S/C18H12N2/c1-3-10-16-12(6-1)13-7-5-9-15-18(13)20(16)17-11-4-2-8-14(17)19-15/h1-6,8-11H,7H2 |
| InChIKey | BWORNCXQAXZNAN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |