C27H30N2O2 — CID 67114740
5-[[2-(3-phenyl-4-phenylmethoxyphenyl)cyclopropyl]amino]pentanamide (PubChem CID 67114740) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 5-[[2-(3-phenyl-4-phenylmethoxyphenyl)cyclopropyl]amino]pentanamide.
| Compound Name | 5-[[2-(3-phenyl-4-phenylmethoxyphenyl)cyclopropyl]amino]pentanamide |
|---|---|
| PubChem CID | 67114740 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 5-[[2-(3-phenyl-4-phenylmethoxyphenyl)cyclopropyl]amino]pentanamide |
| SMILES | NC(=O)CCCCNC1CC1c1ccc(OCc2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H30N2O2/c28-27(30)13-7-8-16-29-25-18-23(25)22-14-15-26(31-19-20-9-3-1-4-10-20)24(17-22)21-11-5-2-6-12-21/h1-6,9-12,14-15,17,23,25,29H,7-8,13,16,18-19H2,(H2,28,30) |
| InChIKey | IWYGLFVIXZODJD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|