C33H48N2O6Si — CID 67116187
tert-butyl N-[[3-[1-[3-[3-[tert-butyl(dimethyl)silyl]oxy-2-oxopropoxy]benzoyl]piperidin-4-yl]phenyl]methyl]carbamate (PubChem CID 67116187) has the molecular formula C33H48N2O6Si and a molecular weight of 596.84 g/mol. Its IUPAC name is tert-butyl N-[[3-[1-[3-[3-[tert-butyl(dimethyl)silyl]oxy-2-oxopropoxy]benzoyl]piperidin-4-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[1-[3-[3-[tert-butyl(dimethyl)silyl]oxy-2-oxopropoxy]benzoyl]piperidin-4-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 67116187 |
| Molecular Formula | C33H48N2O6Si |
| Molecular Weight | 596.84 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | tert-butyl N-[[3-[1-[3-[3-[tert-butyl(dimethyl)silyl]oxy-2-oxopropoxy]benzoyl]piperidin-4-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(C2CCN(C(=O)c3cccc(OCC(=O)CO[Si](C)(C)C(C)(C)C)c3)CC2)c1 |
| InChI | InChI=1S/C33H48N2O6Si/c1-32(2,3)41-31(38)34-21-24-11-9-12-26(19-24)25-15-17-35(18-16-25)30(37)27-13-10-14-29(20-27)39-22-28(36)23-40-42(7,8)33(4,5)6/h9-14,19-20,25H,15-18,21-23H2,1-8H3,(H,34,38) |
| InChIKey | JMLJMTLPQMZDMX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.84 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|