C33H48N2O5Si — CID 86725202
tert-butyl N-[[3-[1-[(E)-3-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxyphenyl]prop-2-enoyl]piperidin-4-yl]phenyl]methyl]carbamate (PubChem CID 86725202) has the molecular formula C33H48N2O5Si and a molecular weight of 580.84 g/mol. Its IUPAC name is tert-butyl N-[[3-[1-[(E)-3-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxyphenyl]prop-2-enoyl]piperidin-4-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[1-[(E)-3-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxyphenyl]prop-2-enoyl]piperidin-4-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 86725202 |
| Molecular Formula | C33H48N2O5Si |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | tert-butyl N-[[3-[1-[(E)-3-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxyphenyl]prop-2-enoyl]piperidin-4-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(C2CCN(C(=O)/C=C/c3cccc(O)c3CO[Si](C)(C)C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C33H48N2O5Si/c1-32(2,3)40-31(38)34-22-24-11-9-13-27(21-24)25-17-19-35(20-18-25)30(37)16-15-26-12-10-14-29(36)28(26)23-39-41(7,8)33(4,5)6/h9-16,21,25,36H,17-20,22-23H2,1-8H3,(H,34,38)/b16-15+ |
| InChIKey | SQSMSVGVHSVJAP-FOCLMDBBSA-N |
| XLogP | 7.36 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|