C29H32N2O7 — CID 90208021
tert-butyl N-[[3-[1-[2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetyl]piperidin-4-yl]phenyl]methyl]carbamate (PubChem CID 90208021) has the molecular formula C29H32N2O7 and a molecular weight of 520.58 g/mol. Its IUPAC name is tert-butyl N-[[3-[1-[2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetyl]piperidin-4-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[1-[2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetyl]piperidin-4-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 90208021 |
| Molecular Formula | C29H32N2O7 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | tert-butyl N-[[3-[1-[2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetyl]piperidin-4-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(C2CCN(C(=O)Cc3cc(=O)oc4cc5c(cc34)OCO5)CC2)c1 |
| InChI | InChI=1S/C29H32N2O7/c1-29(2,3)38-28(34)30-16-18-5-4-6-20(11-18)19-7-9-31(10-8-19)26(32)12-21-13-27(33)37-23-15-25-24(14-22(21)23)35-17-36-25/h4-6,11,13-15,19H,7-10,12,16-17H2,1-3H3,(H,30,34) |
| InChIKey | WJWPBWFRGOZEBM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|