C13H15F2NO3 — CID 67116637
3-(1-amino-3,3-dimethyl-2-oxobutyl)-2,6-difluorobenzoic acid (PubChem CID 67116637) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 3-(1-amino-3,3-dimethyl-2-oxobutyl)-2,6-difluorobenzoic acid.
| Compound Name | 3-(1-amino-3,3-dimethyl-2-oxobutyl)-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 67116637 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-(1-amino-3,3-dimethyl-2-oxobutyl)-2,6-difluorobenzoic acid |
| SMILES | CC(C)(C)C(=O)C(N)c1ccc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C13H15F2NO3/c1-13(2,3)11(17)10(16)6-4-5-7(14)8(9(6)15)12(18)19/h4-5,10H,16H2,1-3H3,(H,18,19) |
| InChIKey | FKRKXRACYOBJPI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |