C20H19N5O4 — CID 67119754
3-(2H-benzotriazole-5-carbonyl)-5-methoxyspiro[1,3-benzoxazine-2,4'-piperidine]-4-one (PubChem CID 67119754) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-(2H-benzotriazole-5-carbonyl)-5-methoxyspiro[1,3-benzoxazine-2,4'-piperidine]-4-one.
| Compound Name | 3-(2H-benzotriazole-5-carbonyl)-5-methoxyspiro[1,3-benzoxazine-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 67119754 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-(2H-benzotriazole-5-carbonyl)-5-methoxyspiro[1,3-benzoxazine-2,4'-piperidine]-4-one |
| SMILES | COc1cccc2c1C(=O)N(C(=O)c1ccc3n[nH]nc3c1)C1(CCNCC1)O2 |
| InChI | InChI=1S/C20H19N5O4/c1-28-15-3-2-4-16-17(15)19(27)25(20(29-16)7-9-21-10-8-20)18(26)12-5-6-13-14(11-12)23-24-22-13/h2-6,11,21H,7-10H2,1H3,(H,22,23,24) |
| InChIKey | GPUYFBGVXFEGLJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|