C15H12BrF3N2O — CID 67119857
2-N-(4-bromo-2-fluoro-6-prop-2-enoxyphenyl)-3,4-difluorobenzene-1,2-diamine (PubChem CID 67119857) has the molecular formula C15H12BrF3N2O and a molecular weight of 373.17 g/mol. Its IUPAC name is 2-N-(4-bromo-2-fluoro-6-prop-2-enoxyphenyl)-3,4-difluorobenzene-1,2-diamine.
| Compound Name | 2-N-(4-bromo-2-fluoro-6-prop-2-enoxyphenyl)-3,4-difluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 67119857 |
| Molecular Formula | C15H12BrF3N2O |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2-N-(4-bromo-2-fluoro-6-prop-2-enoxyphenyl)-3,4-difluorobenzene-1,2-diamine |
| SMILES | C=CCOc1cc(Br)cc(F)c1Nc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C15H12BrF3N2O/c1-2-5-22-12-7-8(16)6-10(18)14(12)21-15-11(20)4-3-9(17)13(15)19/h2-4,6-7,21H,1,5,20H2 |
| InChIKey | GTEYTSREJSSNSJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|