C15H14ClFN2O3 — CID 67121088
4-chloro-5-(4-fluorophenyl)-N-(oxan-4-yl)-1,2-oxazole-3-carboxamide (PubChem CID 67121088) has the molecular formula C15H14ClFN2O3 and a molecular weight of 324.74 g/mol. Its IUPAC name is 4-chloro-5-(4-fluorophenyl)-N-(oxan-4-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 4-chloro-5-(4-fluorophenyl)-N-(oxan-4-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 67121088 |
| Molecular Formula | C15H14ClFN2O3 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-chloro-5-(4-fluorophenyl)-N-(oxan-4-yl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCOCC1)c1noc(-c2ccc(F)cc2)c1Cl |
| InChI | InChI=1S/C15H14ClFN2O3/c16-12-13(15(20)18-11-5-7-21-8-6-11)19-22-14(12)9-1-3-10(17)4-2-9/h1-4,11H,5-8H2,(H,18,20) |
| InChIKey | WMOBBEAKRBZQLE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |