C11H12ClFN2O2 — CID 100628497
4-chloro-3-fluoro-N-(oxan-4-yl)pyridine-2-carboxamide (PubChem CID 100628497) has the molecular formula C11H12ClFN2O2 and a molecular weight of 258.68 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-(oxan-4-yl)pyridine-2-carboxamide.
| Compound Name | 4-chloro-3-fluoro-N-(oxan-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 100628497 |
| Molecular Formula | C11H12ClFN2O2 |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-chloro-3-fluoro-N-(oxan-4-yl)pyridine-2-carboxamide |
| SMILES | O=C(NC1CCOCC1)c1nccc(Cl)c1F |
| InChI | InChI=1S/C11H12ClFN2O2/c12-8-1-4-14-10(9(8)13)11(16)15-7-2-5-17-6-3-7/h1,4,7H,2-3,5-6H2,(H,15,16) |
| InChIKey | VHOCPYBAJFRYRB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |