C22H25ClF3N3O — CID 87301652
2-chloro-N-[4-[[(2,4-dimethyl-3-pyridinyl)amino]methyl]cyclohexyl]-3,4,6-trifluoro-5-methylbenzamide (PubChem CID 87301652) has the molecular formula C22H25ClF3N3O and a molecular weight of 439.91 g/mol. Its IUPAC name is 2-chloro-N-[4-[[(2,4-dimethyl-3-pyridinyl)amino]methyl]cyclohexyl]-3,4,6-trifluoro-5-methylbenzamide.
| Compound Name | 2-chloro-N-[4-[[(2,4-dimethyl-3-pyridinyl)amino]methyl]cyclohexyl]-3,4,6-trifluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 87301652 |
| Molecular Formula | C22H25ClF3N3O |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-chloro-N-[4-[[(2,4-dimethyl-3-pyridinyl)amino]methyl]cyclohexyl]-3,4,6-trifluoro-5-methylbenzamide |
| SMILES | Cc1ccnc(C)c1NCC1CCC(NC(=O)c2c(F)c(C)c(F)c(F)c2Cl)CC1 |
| InChI | InChI=1S/C22H25ClF3N3O/c1-11-8-9-27-13(3)21(11)28-10-14-4-6-15(7-5-14)29-22(30)16-17(23)20(26)19(25)12(2)18(16)24/h8-9,14-15,28H,4-7,10H2,1-3H3,(H,29,30) |
| InChIKey | CTNBBRFBQPICFZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|