C22H22ClF3N6O — CID 87320521
2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[[(1-phenyltetrazol-5-yl)amino]methyl]cyclohexyl]benzamide (PubChem CID 87320521) has the molecular formula C22H22ClF3N6O and a molecular weight of 478.91 g/mol. Its IUPAC name is 2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[[(1-phenyltetrazol-5-yl)amino]methyl]cyclohexyl]benzamide.
| Compound Name | 2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[[(1-phenyltetrazol-5-yl)amino]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 87320521 |
| Molecular Formula | C22H22ClF3N6O |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[[(1-phenyltetrazol-5-yl)amino]methyl]cyclohexyl]benzamide |
| SMILES | Cc1c(F)c(F)c(Cl)c(C(=O)NC2CCC(CNc3nnnn3-c3ccccc3)CC2)c1F |
| InChI | InChI=1S/C22H22ClF3N6O/c1-12-18(24)16(17(23)20(26)19(12)25)21(33)28-14-9-7-13(8-10-14)11-27-22-29-30-31-32(22)15-5-3-2-4-6-15/h2-6,13-14H,7-11H2,1H3,(H,28,33)(H,27,29,31) |
| InChIKey | LYHDIFIEDKMSMO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|