C19H27N5O2S — CID 67445741
tert-butyl N-[4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]cyclohexyl]carbamate (PubChem CID 67445741) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is tert-butyl N-[4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 67445741 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | tert-butyl N-[4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CSc2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N5O2S/c1-19(2,3)26-18(25)20-15-11-9-14(10-12-15)13-27-17-21-22-23-24(17)16-7-5-4-6-8-16/h4-8,14-15H,9-13H2,1-3H3,(H,20,25) |
| InChIKey | XXPURLXWCDZBLP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |