C23H24ClF3N4O — CID 87320527
2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[[(5-methyl-1H-indazol-3-yl)amino]methyl]cyclohexyl]benzamide (PubChem CID 87320527) has the molecular formula C23H24ClF3N4O and a molecular weight of 464.92 g/mol. Its IUPAC name is 2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[[(5-methyl-1H-indazol-3-yl)amino]methyl]cyclohexyl]benzamide.
| Compound Name | 2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[[(5-methyl-1H-indazol-3-yl)amino]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 87320527 |
| Molecular Formula | C23H24ClF3N4O |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[[(5-methyl-1H-indazol-3-yl)amino]methyl]cyclohexyl]benzamide |
| SMILES | Cc1ccc2[nH]nc(NCC3CCC(NC(=O)c4c(F)c(C)c(F)c(F)c4Cl)CC3)c2c1 |
| InChI | InChI=1S/C23H24ClF3N4O/c1-11-3-8-16-15(9-11)22(31-30-16)28-10-13-4-6-14(7-5-13)29-23(32)17-18(24)21(27)20(26)12(2)19(17)25/h3,8-9,13-14H,4-7,10H2,1-2H3,(H,29,32)(H2,28,30,31) |
| InChIKey | TYSLEPDMHKRBIU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|