C23H22ClF3N4O — CID 87370595
2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[(3-pyridin-4-ylpyrazol-1-yl)methyl]cyclohexyl]benzamide (PubChem CID 87370595) has the molecular formula C23H22ClF3N4O and a molecular weight of 462.90 g/mol. Its IUPAC name is 2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[(3-pyridin-4-ylpyrazol-1-yl)methyl]cyclohexyl]benzamide.
| Compound Name | 2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[(3-pyridin-4-ylpyrazol-1-yl)methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 87370595 |
| Molecular Formula | C23H22ClF3N4O |
| Molecular Weight | 462.90 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-chloro-3,4,6-trifluoro-5-methyl-N-[4-[(3-pyridin-4-ylpyrazol-1-yl)methyl]cyclohexyl]benzamide |
| SMILES | Cc1c(F)c(F)c(Cl)c(C(=O)NC2CCC(Cn3ccc(-c4ccncc4)n3)CC2)c1F |
| InChI | InChI=1S/C23H22ClF3N4O/c1-13-20(25)18(19(24)22(27)21(13)26)23(32)29-16-4-2-14(3-5-16)12-31-11-8-17(30-31)15-6-9-28-10-7-15/h6-11,14,16H,2-5,12H2,1H3,(H,29,32) |
| InChIKey | ZSPRWJDFJOGEQP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.90 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|