C21H26ClN3O — CID 143937089
2-chloro-5-methyl-N-[4-[[(5-methyl-3-pyridinyl)amino]methyl]cyclohexyl]benzamide (PubChem CID 143937089) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is 2-chloro-5-methyl-N-[4-[[(5-methyl-3-pyridinyl)amino]methyl]cyclohexyl]benzamide.
| Compound Name | 2-chloro-5-methyl-N-[4-[[(5-methyl-3-pyridinyl)amino]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 143937089 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-chloro-5-methyl-N-[4-[[(5-methyl-3-pyridinyl)amino]methyl]cyclohexyl]benzamide |
| SMILES | Cc1cncc(NCC2CCC(NC(=O)c3cc(C)ccc3Cl)CC2)c1 |
| InChI | InChI=1S/C21H26ClN3O/c1-14-3-8-20(22)19(10-14)21(26)25-17-6-4-16(5-7-17)12-24-18-9-15(2)11-23-13-18/h3,8-11,13,16-17,24H,4-7,12H2,1-2H3,(H,25,26) |
| InChIKey | PYUOMPUZARJLIK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |