C20H23Cl2N3O2 — CID 68544319
2,5-dichloro-N-[4-[[(6-methoxy-2-pyridinyl)amino]methyl]cyclohexyl]benzamide (PubChem CID 68544319) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-[[(6-methoxy-2-pyridinyl)amino]methyl]cyclohexyl]benzamide.
| Compound Name | 2,5-dichloro-N-[4-[[(6-methoxy-2-pyridinyl)amino]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 68544319 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2,5-dichloro-N-[4-[[(6-methoxy-2-pyridinyl)amino]methyl]cyclohexyl]benzamide |
| SMILES | COc1cccc(NCC2CCC(NC(=O)c3cc(Cl)ccc3Cl)CC2)n1 |
| InChI | InChI=1S/C20H23Cl2N3O2/c1-27-19-4-2-3-18(25-19)23-12-13-5-8-15(9-6-13)24-20(26)16-11-14(21)7-10-17(16)22/h2-4,7,10-11,13,15H,5-6,8-9,12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | XIAQWRZXEBSIHO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |