C11H22NO3+ — CID 67123363
(3S)-1-tert-butyl-3-(hydroxymethyl)piperidin-1-ium-1-carboxylic acid (PubChem CID 67123363) has the molecular formula C11H22NO3+ and a molecular weight of 216.30 g/mol. Its IUPAC name is (3S)-1-tert-butyl-3-(hydroxymethyl)piperidin-1-ium-1-carboxylic acid.
| Compound Name | (3S)-1-tert-butyl-3-(hydroxymethyl)piperidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 67123363 |
| Molecular Formula | C11H22NO3+ |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (3S)-1-tert-butyl-3-(hydroxymethyl)piperidin-1-ium-1-carboxylic acid |
| SMILES | CC(C)(C)[N+]1(C(=O)O)CCC[C@H](CO)C1 |
| InChI | InChI=1S/C11H21NO3/c1-11(2,3)12(10(14)15)6-4-5-9(7-12)8-13/h9,13H,4-8H2,1-3H3/p+1/t9-,12?/m0/s1 |
| InChIKey | OBZQODHBLBRKIX-QHGLUPRGSA-O |
| XLogP | 1.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|