C25H32FN7O3Si — CID 67123934
9-[(3R)-1-acetylpiperidin-3-yl]-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-trimethylsilylethoxymethyl)purin-8-one (PubChem CID 67123934) has the molecular formula C25H32FN7O3Si and a molecular weight of 525.66 g/mol. Its IUPAC name is 9-[(3R)-1-acetylpiperidin-3-yl]-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-trimethylsilylethoxymethyl)purin-8-one.
| Compound Name | 9-[(3R)-1-acetylpiperidin-3-yl]-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-trimethylsilylethoxymethyl)purin-8-one |
|---|---|
| PubChem CID | 67123934 |
| Molecular Formula | C25H32FN7O3Si |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 9-[(3R)-1-acetylpiperidin-3-yl]-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-7-(2-trimethylsilylethoxymethyl)purin-8-one |
| SMILES | CC(=O)N1CCC[C@@H](n2c(=O)n(COCC[Si](C)(C)C)c3cnc(-c4cnc5ccc(F)cn45)nc32)C1 |
| InChI | InChI=1S/C25H32FN7O3Si/c1-17(34)30-9-5-6-19(15-30)33-24-21(32(25(33)35)16-36-10-11-37(2,3)4)13-28-23(29-24)20-12-27-22-8-7-18(26)14-31(20)22/h7-8,12-14,19H,5-6,9-11,15-16H2,1-4H3/t19-/m1/s1 |
| InChIKey | DZRVHXJGUUWJAX-LJQANCHMSA-N |
| XLogP | 3.54 |
| TPSA | 99.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|