C5H11N3O — CID 67127715
3,6-diaminopiperidin-2-one (PubChem CID 67127715) has the molecular formula C5H11N3O and a molecular weight of 129.16 g/mol. Its IUPAC name is 3,6-diaminopiperidin-2-one.
| Compound Name | 3,6-diaminopiperidin-2-one |
|---|---|
| PubChem CID | 67127715 |
| Molecular Formula | C5H11N3O |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | 3,6-diaminopiperidin-2-one |
| SMILES | NC1CCC(N)C(=O)N1 |
| InChI | InChI=1S/C5H11N3O/c6-3-1-2-4(7)8-5(3)9/h3-4H,1-2,6-7H2,(H,8,9) |
| InChIKey | BDKQXZUMDKTHDH-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |