C20H21ClN2O4 — CID 67129331
methyl 3-[4-chloro-2-[[(2R)-oxolane-2-carbonyl]amino]anilino]-2-methylbenzoate (PubChem CID 67129331) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is methyl 3-[4-chloro-2-[[(2R)-oxolane-2-carbonyl]amino]anilino]-2-methylbenzoate.
| Compound Name | methyl 3-[4-chloro-2-[[(2R)-oxolane-2-carbonyl]amino]anilino]-2-methylbenzoate |
|---|---|
| PubChem CID | 67129331 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | methyl 3-[4-chloro-2-[[(2R)-oxolane-2-carbonyl]amino]anilino]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(Nc2ccc(Cl)cc2NC(=O)[C@H]2CCCO2)c1C |
| InChI | InChI=1S/C20H21ClN2O4/c1-12-14(20(25)26-2)5-3-6-15(12)22-16-9-8-13(21)11-17(16)23-19(24)18-7-4-10-27-18/h3,5-6,8-9,11,18,22H,4,7,10H2,1-2H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | CPKURIGBQXBJQF-GOSISDBHSA-N |
| XLogP | 4.30 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |