C12H11ClN2 — CID 67135612
4-(2-chlorocyclopent-2-en-1-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 67135612) has the molecular formula C12H11ClN2 and a molecular weight of 218.69 g/mol. Its IUPAC name is 4-(2-chlorocyclopent-2-en-1-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(2-chlorocyclopent-2-en-1-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 67135612 |
| Molecular Formula | C12H11ClN2 |
| Molecular Weight | 218.69 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 4-(2-chlorocyclopent-2-en-1-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | ClC1=CCCC1c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C12H11ClN2/c13-11-3-1-2-9(11)8-4-6-14-12-10(8)5-7-15-12/h3-7,9H,1-2H2,(H,14,15) |
| InChIKey | SZACHRMQEYYYHR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |