C19H20O7 — CID 67135914
2-[3-hydroxy-2-[3-[4-(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoyl]phenoxy]acetic acid (PubChem CID 67135914) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-[3-hydroxy-2-[3-[4-(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-hydroxy-2-[3-[4-(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67135914 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[3-hydroxy-2-[3-[4-(2-hydroxyethoxy)cyclohexa-2,4-dien-1-yl]prop-2-enoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(O)c1C(=O)C=CC1C=CC(OCCO)=CC1 |
| InChI | InChI=1S/C19H20O7/c20-10-11-25-14-7-4-13(5-8-14)6-9-16(22)19-15(21)2-1-3-17(19)26-12-18(23)24/h1-4,6-9,13,20-21H,5,10-12H2,(H,23,24) |
| InChIKey | CAGBRVWNSIQLGF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|