C18H22O4 — CID 67137581
[2-(2,5-dimethylphenyl)-1-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate (PubChem CID 67137581) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-1-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate.
| Compound Name | [2-(2,5-dimethylphenyl)-1-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67137581 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-1-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(Cc1cc(C)ccc1C)OC(=O)C(=C)C |
| InChI | InChI=1S/C18H22O4/c1-11(2)17(19)21-16(22-18(20)12(3)4)10-15-9-13(5)7-8-14(15)6/h7-9,16H,1,3,10H2,2,4-6H3 |
| InChIKey | IPFVHZPMEXQSSI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|