C30H41BrN4O7 — CID 67139385
2-[2-tert-butyl-4-[2-[6-(dimethylamino)-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-(4-hydroxybutoxy)phenoxy]acetic acid;hydrobromide (PubChem CID 67139385) has the molecular formula C30H41BrN4O7 and a molecular weight of 649.58 g/mol. Its IUPAC name is 2-[2-tert-butyl-4-[2-[6-(dimethylamino)-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-(4-hydroxybutoxy)phenoxy]acetic acid;hydrobromide.
| Compound Name | 2-[2-tert-butyl-4-[2-[6-(dimethylamino)-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-(4-hydroxybutoxy)phenoxy]acetic acid;hydrobromide |
|---|---|
| PubChem CID | 67139385 |
| Molecular Formula | C30H41BrN4O7 |
| Molecular Weight | 649.58 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | 2-[2-tert-butyl-4-[2-[6-(dimethylamino)-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-(4-hydroxybutoxy)phenoxy]acetic acid;hydrobromide |
| SMILES | Br.[H]/N=C1/c2cc(C(=O)NC)c(N(C)C)cc2CN1CC(=O)c1cc(OCCCCO)c(OCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H40N4O7.BrH/c1-30(2,3)22-11-18(13-25(40-10-8-7-9-35)27(22)41-17-26(37)38)24(36)16-34-15-19-12-23(33(5)6)21(29(39)32-4)14-20(19)28(34)31;/h11-14,31,35H,7-10,15-17H2,1-6H3,(H,32,39)(H,37,38);1H/b31-28-; |
| InChIKey | AQTAOXLEDNPGCT-GIBMLHLSSA-N |
| XLogP | 3.63 |
| TPSA | 152.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|