C20H26ClN3 — CID 67141912
3-(2,3-dimethyl-1H-pyrrolo[2,3-c]pyridin-7-yl)-N-[(2-methylphenyl)methyl]propan-1-amine;hydrochloride (PubChem CID 67141912) has the molecular formula C20H26ClN3 and a molecular weight of 343.90 g/mol. Its IUPAC name is 3-(2,3-dimethyl-1H-pyrrolo[2,3-c]pyridin-7-yl)-N-[(2-methylphenyl)methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-(2,3-dimethyl-1H-pyrrolo[2,3-c]pyridin-7-yl)-N-[(2-methylphenyl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 67141912 |
| Molecular Formula | C20H26ClN3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3-(2,3-dimethyl-1H-pyrrolo[2,3-c]pyridin-7-yl)-N-[(2-methylphenyl)methyl]propan-1-amine;hydrochloride |
| SMILES | Cc1ccccc1CNCCCc1nccc2c(C)c(C)[nH]c12.Cl |
| InChI | InChI=1S/C20H25N3.ClH/c1-14-7-4-5-8-17(14)13-21-11-6-9-19-20-18(10-12-22-19)15(2)16(3)23-20;/h4-5,7-8,10,12,21,23H,6,9,11,13H2,1-3H3;1H |
| InChIKey | CNXHJKKJCPDHBM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|