C19H36Cl2N2 — CID 17214735
N',N'-dibutyl-N-[(2-methylphenyl)methyl]propane-1,3-diamine;dihydrochloride (PubChem CID 17214735) has the molecular formula C19H36Cl2N2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N',N'-dibutyl-N-[(2-methylphenyl)methyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dibutyl-N-[(2-methylphenyl)methyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17214735 |
| Molecular Formula | C19H36Cl2N2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | N',N'-dibutyl-N-[(2-methylphenyl)methyl]propane-1,3-diamine;dihydrochloride |
| SMILES | CCCCN(CCCC)CCCNCc1ccccc1C.Cl.Cl |
| InChI | InChI=1S/C19H34N2.2ClH/c1-4-6-14-21(15-7-5-2)16-10-13-20-17-19-12-9-8-11-18(19)3;;/h8-9,11-12,20H,4-7,10,13-17H2,1-3H3;2*1H |
| InChIKey | FJVJNGBJNZCRIA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|