C19H22O — CID 67143181
8-propan-2-ylspiro[3,4-dihydronaphthalene-1,5'-bicyclo[2.2.1]hept-1-ene]-2-one (PubChem CID 67143181) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 8-propan-2-ylspiro[3,4-dihydronaphthalene-1,5'-bicyclo[2.2.1]hept-1-ene]-2-one.
| Compound Name | 8-propan-2-ylspiro[3,4-dihydronaphthalene-1,5'-bicyclo[2.2.1]hept-1-ene]-2-one |
|---|---|
| PubChem CID | 67143181 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 8-propan-2-ylspiro[3,4-dihydronaphthalene-1,5'-bicyclo[2.2.1]hept-1-ene]-2-one |
| SMILES | CC(C)c1cccc2c1C1(CC3=CCC1C3)C(=O)CC2 |
| InChI | InChI=1S/C19H22O/c1-12(2)16-5-3-4-14-7-9-17(20)19(18(14)16)11-13-6-8-15(19)10-13/h3-6,12,15H,7-11H2,1-2H3 |
| InChIKey | OIEFPUDTUFMUIM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|