C21H20BrNO3 — CID 67148633
benzyl 2-[(2-bromo-1-benzofuran-3-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 67148633) has the molecular formula C21H20BrNO3 and a molecular weight of 414.30 g/mol. Its IUPAC name is benzyl 2-[(2-bromo-1-benzofuran-3-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(2-bromo-1-benzofuran-3-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67148633 |
| Molecular Formula | C21H20BrNO3 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | benzyl 2-[(2-bromo-1-benzofuran-3-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC1Cc1c(Br)oc2ccccc12 |
| InChI | InChI=1S/C21H20BrNO3/c22-20-18(17-10-4-5-11-19(17)26-20)13-16-9-6-12-23(16)21(24)25-14-15-7-2-1-3-8-15/h1-5,7-8,10-11,16H,6,9,12-14H2 |
| InChIKey | JBFLGLOYKPKMHJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |