C14H24ClNOSi — CID 67148850
[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methanamine (PubChem CID 67148850) has the molecular formula C14H24ClNOSi and a molecular weight of 285.89 g/mol. Its IUPAC name is [3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methanamine.
| Compound Name | [3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methanamine |
|---|---|
| PubChem CID | 67148850 |
| Molecular Formula | C14H24ClNOSi |
| Molecular Weight | 285.89 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | [3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chlorophenyl]methanamine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(CN)ccc1Cl |
| InChI | InChI=1S/C14H24ClNOSi/c1-14(2,3)18(4,5)17-10-12-8-11(9-16)6-7-13(12)15/h6-8H,9-10,16H2,1-5H3 |
| InChIKey | JSZCCOCTUUPOEP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.89 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|