About trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one
trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one (PubChem CID 67149597) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one |
| PubChem CID | 67149597 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one |
| SMILES | CC1C[C@@H](CO)C(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C9H16O2/c1-6-3-7(2)9(11)8(4-6)5-10/h6-8,10H,3-5H2,1-2H3/t6?,7-,8-/m0/s1 |
| InChIKey | XKQPRQGTOYLWPL-ALKRTJFJSA-N |
| XLogP | 1.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one?
The IUPAC name of trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one (CID 67149597) is trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one.
What is the SMILES notation for trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one?
The canonical SMILES for trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one is CC1C[C@@H](CO)C(=O)[C@@H](C)C1.
What is the InChIKey of trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one?
The InChIKey is XKQPRQGTOYLWPL-ALKRTJFJSA-N. The full InChI is InChI=1S/C9H16O2/c1-6-3-7(2)9(11)8(4-6)5-10/h6-8,10H,3-5H2,1-2H3/t6?,7-,8-/m0/s1.
What are the key properties of trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one?
trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one has a molecular weight of 156.22 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,6S)-2-(hydroxymethyl)-4,6-dimethylcyclohexan-1-one is sourced from PubChem (CID 67149597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).