C9H16O2 — CID 145284011
6-(hydroxymethyl)-2,4-dimethylcyclohexen-1-ol (PubChem CID 145284011) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 6-(hydroxymethyl)-2,4-dimethylcyclohexen-1-ol.
| Compound Name | 6-(hydroxymethyl)-2,4-dimethylcyclohexen-1-ol |
|---|---|
| PubChem CID | 145284011 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 6-(hydroxymethyl)-2,4-dimethylcyclohexen-1-ol |
| SMILES | CC1=C(O)C(CO)CC(C)C1 |
| InChI | InChI=1S/C9H16O2/c1-6-3-7(2)9(11)8(4-6)5-10/h6,8,10-11H,3-5H2,1-2H3 |
| InChIKey | KJTSDDWPHJEDKU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |