C9H16 — CID 123584374
1-ethyl-2,4-dimethylcyclopentene (PubChem CID 123584374) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethylcyclopentene.
| Compound Name | 1-ethyl-2,4-dimethylcyclopentene |
|---|---|
| PubChem CID | 123584374 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 1-ethyl-2,4-dimethylcyclopentene |
| SMILES | CCC1=C(C)CC(C)C1 |
| InChI | InChI=1S/C9H16/c1-4-9-6-7(2)5-8(9)3/h7H,4-6H2,1-3H3 |
| InChIKey | GZLNKGWBVLPTHR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|