C9H14F3NO — CID 158549676
(2Z)-2-[(2S,4S)-2-amino-4-methylcyclopentylidene]-3,3,3-trifluoropropan-1-ol (PubChem CID 158549676) has the molecular formula C9H14F3NO and a molecular weight of 209.21 g/mol. Its IUPAC name is (2Z)-2-[(2S,4S)-2-amino-4-methylcyclopentylidene]-3,3,3-trifluoropropan-1-ol.
| Compound Name | (2Z)-2-[(2S,4S)-2-amino-4-methylcyclopentylidene]-3,3,3-trifluoropropan-1-ol |
|---|---|
| PubChem CID | 158549676 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (2Z)-2-[(2S,4S)-2-amino-4-methylcyclopentylidene]-3,3,3-trifluoropropan-1-ol |
| SMILES | C[C@H]1C/C(=C(\CO)C(F)(F)F)[C@@H](N)C1 |
| InChI | InChI=1S/C9H14F3NO/c1-5-2-6(8(13)3-5)7(4-14)9(10,11)12/h5,8,14H,2-4,13H2,1H3/b7-6-/t5-,8-/m0/s1 |
| InChIKey | XKRUOOAEEIAQRJ-YHODWOBOSA-N |
| XLogP | 1.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|