C8H15O+ — CID 140563406
(3,5-dimethylcyclohexylidene)oxidanium (PubChem CID 140563406) has the molecular formula C8H15O+ and a molecular weight of 127.21 g/mol. Its IUPAC name is (3,5-dimethylcyclohexylidene)oxidanium.
| Compound Name | (3,5-dimethylcyclohexylidene)oxidanium |
|---|---|
| PubChem CID | 140563406 |
| Molecular Formula | C8H15O+ |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | (3,5-dimethylcyclohexylidene)oxidanium |
| SMILES | [H][O+]=C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C8H14O/c1-6-3-7(2)5-8(9)4-6/h6-7H,3-5H2,1-2H3/p+1 |
| InChIKey | MSANHHHQJYQEOK-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 21.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|