C23H25F2N3O3 — CID 67151504
N-(2-cyanoethyl)-3-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]piperidine-1-carboxamide (PubChem CID 67151504) has the molecular formula C23H25F2N3O3 and a molecular weight of 429.47 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]piperidine-1-carboxamide.
| Compound Name | N-(2-cyanoethyl)-3-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 67151504 |
| Molecular Formula | C23H25F2N3O3 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-(2-cyanoethyl)-3-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]piperidine-1-carboxamide |
| SMILES | COc1cc(F)c(F)cc1-c1ccc(OCC2CCCN(C(=O)NCCC#N)C2)cc1 |
| InChI | InChI=1S/C23H25F2N3O3/c1-30-22-13-21(25)20(24)12-19(22)17-5-7-18(8-6-17)31-15-16-4-2-11-28(14-16)23(29)27-10-3-9-26/h5-8,12-13,16H,2-4,10-11,14-15H2,1H3,(H,27,29) |
| InChIKey | ZAJOXGLQYDOVIM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|