C8H12F3NO4 — CID 67159791
piperidine-1-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 67159791) has the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. Its IUPAC name is piperidine-1-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | piperidine-1-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67159791 |
| Molecular Formula | C8H12F3NO4 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | piperidine-1-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)N1CCCCC1 |
| InChI | InChI=1S/C6H11NO2.C2HF3O2/c8-6(9)7-4-2-1-3-5-7;3-2(4,5)1(6)7/h1-5H2,(H,8,9);(H,6,7) |
| InChIKey | GGEANMOTYYNNNI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |