C31H32N2O5 — CID 67159886
tert-butyl 2-[4-[5-(4-ethylphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxycyclopent-2-en-1-yl]oxyacetate (PubChem CID 67159886) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is tert-butyl 2-[4-[5-(4-ethylphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxycyclopent-2-en-1-yl]oxyacetate.
| Compound Name | tert-butyl 2-[4-[5-(4-ethylphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxycyclopent-2-en-1-yl]oxyacetate |
|---|---|
| PubChem CID | 67159886 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | tert-butyl 2-[4-[5-(4-ethylphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxycyclopent-2-en-1-yl]oxyacetate |
| SMILES | CCc1ccc(-c2c(-c3ccccc3)oc3ncnc(OC4C=CC(OCC(=O)OC(C)(C)C)C4)c23)cc1 |
| InChI | InChI=1S/C31H32N2O5/c1-5-20-11-13-21(14-12-20)26-27-29(32-19-33-30(27)37-28(26)22-9-7-6-8-10-22)36-24-16-15-23(17-24)35-18-25(34)38-31(2,3)4/h6-16,19,23-24H,5,17-18H2,1-4H3 |
| InChIKey | OEPBOQISTCFUHK-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|