C31H35FN2O4 — CID 58016900
tert-butyl (6R)-6-[5-(4-ethylphenyl)-6-(2-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]oxyheptanoate (PubChem CID 58016900) has the molecular formula C31H35FN2O4 and a molecular weight of 518.63 g/mol. Its IUPAC name is tert-butyl (6R)-6-[5-(4-ethylphenyl)-6-(2-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]oxyheptanoate.
| Compound Name | tert-butyl (6R)-6-[5-(4-ethylphenyl)-6-(2-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]oxyheptanoate |
|---|---|
| PubChem CID | 58016900 |
| Molecular Formula | C31H35FN2O4 |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | tert-butyl (6R)-6-[5-(4-ethylphenyl)-6-(2-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]oxyheptanoate |
| SMILES | CCc1ccc(-c2c(-c3ccccc3F)oc3ncnc(O[C@H](C)CCCCC(=O)OC(C)(C)C)c23)cc1 |
| InChI | InChI=1S/C31H35FN2O4/c1-6-21-15-17-22(18-16-21)26-27-29(36-20(2)11-7-10-14-25(35)38-31(3,4)5)33-19-34-30(27)37-28(26)23-12-8-9-13-24(23)32/h8-9,12-13,15-20H,6-7,10-11,14H2,1-5H3/t20-/m1/s1 |
| InChIKey | LLNWOAJSOINGAH-HXUWFJFHSA-N |
| XLogP | 7.93 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|