C25H30N2O4 — CID 59544057
tert-butyl (6R)-6-(5-ethenyl-6-phenylfuro[2,3-d]pyrimidin-4-yl)oxyheptanoate (PubChem CID 59544057) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is tert-butyl (6R)-6-(5-ethenyl-6-phenylfuro[2,3-d]pyrimidin-4-yl)oxyheptanoate.
| Compound Name | tert-butyl (6R)-6-(5-ethenyl-6-phenylfuro[2,3-d]pyrimidin-4-yl)oxyheptanoate |
|---|---|
| PubChem CID | 59544057 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | tert-butyl (6R)-6-(5-ethenyl-6-phenylfuro[2,3-d]pyrimidin-4-yl)oxyheptanoate |
| SMILES | C=Cc1c(-c2ccccc2)oc2ncnc(O[C@H](C)CCCCC(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C25H30N2O4/c1-6-19-21-23(29-17(2)12-10-11-15-20(28)31-25(3,4)5)26-16-27-24(21)30-22(19)18-13-8-7-9-14-18/h6-9,13-14,16-17H,1,10-12,15H2,2-5H3/t17-/m1/s1 |
| InChIKey | ARRBGSSJODELRT-QGZVFWFLSA-N |
| XLogP | 6.20 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|