C25H26N2O6 — CID 59544065
(6R)-6-[5-[(E)-3-oxo-3-prop-2-enoxyprop-1-enyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid (PubChem CID 59544065) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is (6R)-6-[5-[(E)-3-oxo-3-prop-2-enoxyprop-1-enyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid.
| Compound Name | (6R)-6-[5-[(E)-3-oxo-3-prop-2-enoxyprop-1-enyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid |
|---|---|
| PubChem CID | 59544065 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (6R)-6-[5-[(E)-3-oxo-3-prop-2-enoxyprop-1-enyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid |
| SMILES | C=CCOC(=O)/C=C/c1c(-c2ccccc2)oc2ncnc(O[C@H](C)CCCCC(=O)O)c12 |
| InChI | InChI=1S/C25H26N2O6/c1-3-15-31-21(30)14-13-19-22-24(32-17(2)9-7-8-12-20(28)29)26-16-27-25(22)33-23(19)18-10-5-4-6-11-18/h3-6,10-11,13-14,16-17H,1,7-9,12,15H2,2H3,(H,28,29)/b14-13+/t17-/m1/s1 |
| InChIKey | BFYOVYLQACHBFO-TUQDCPSNSA-N |
| XLogP | 5.04 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|