C21H25NO3 — CID 68571654
3-amino-4-oct-7-en-2-yloxy-2-phenylbenzoic acid (PubChem CID 68571654) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-amino-4-oct-7-en-2-yloxy-2-phenylbenzoic acid.
| Compound Name | 3-amino-4-oct-7-en-2-yloxy-2-phenylbenzoic acid |
|---|---|
| PubChem CID | 68571654 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 3-amino-4-oct-7-en-2-yloxy-2-phenylbenzoic acid |
| SMILES | C=CCCCCC(C)Oc1ccc(C(=O)O)c(-c2ccccc2)c1N |
| InChI | InChI=1S/C21H25NO3/c1-3-4-5-7-10-15(2)25-18-14-13-17(21(23)24)19(20(18)22)16-11-8-6-9-12-16/h3,6,8-9,11-15H,1,4-5,7,10,22H2,2H3,(H,23,24) |
| InChIKey | OQKSYCUKFZWRIY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|