C24H22N2O4 — CID 87349866
(6R)-6-(5-cyclopenta-1,2,4-trien-1-yl-6-phenylfuro[2,3-d]pyrimidin-4-yl)oxyheptanoic acid (PubChem CID 87349866) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is (6R)-6-(5-cyclopenta-1,2,4-trien-1-yl-6-phenylfuro[2,3-d]pyrimidin-4-yl)oxyheptanoic acid.
| Compound Name | (6R)-6-(5-cyclopenta-1,2,4-trien-1-yl-6-phenylfuro[2,3-d]pyrimidin-4-yl)oxyheptanoic acid |
|---|---|
| PubChem CID | 87349866 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (6R)-6-(5-cyclopenta-1,2,4-trien-1-yl-6-phenylfuro[2,3-d]pyrimidin-4-yl)oxyheptanoic acid |
| SMILES | C[C@H](CCCCC(=O)O)Oc1ncnc2oc(-c3ccccc3)c(C3=C=CC=C3)c12 |
| InChI | InChI=1S/C24H22N2O4/c1-16(9-5-8-14-19(27)28)29-23-21-20(17-10-6-7-11-17)22(18-12-3-2-4-13-18)30-24(21)26-15-25-23/h2-4,6-7,10,12-13,15-16H,5,8-9,14H2,1H3,(H,27,28)/t16-/m1/s1 |
| InChIKey | HRVJLTKZUYEUAZ-MRXNPFEDSA-N |
| XLogP | 5.41 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|