C24H27N3O5 — CID 68504007
(6R)-6-[5-[3-(ethylamino)-3-oxoprop-1-enyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid (PubChem CID 68504007) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is (6R)-6-[5-[3-(ethylamino)-3-oxoprop-1-enyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid.
| Compound Name | (6R)-6-[5-[3-(ethylamino)-3-oxoprop-1-enyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid |
|---|---|
| PubChem CID | 68504007 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (6R)-6-[5-[3-(ethylamino)-3-oxoprop-1-enyl]-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid |
| SMILES | CCNC(=O)C=Cc1c(-c2ccccc2)oc2ncnc(O[C@H](C)CCCCC(=O)O)c12 |
| InChI | InChI=1S/C24H27N3O5/c1-3-25-19(28)14-13-18-21-23(31-16(2)9-7-8-12-20(29)30)26-15-27-24(21)32-22(18)17-10-5-4-6-11-17/h4-6,10-11,13-16H,3,7-9,12H2,1-2H3,(H,25,28)(H,29,30)/t16-/m1/s1 |
| InChIKey | JPRJGANADBEZGS-MRXNPFEDSA-N |
| XLogP | 4.45 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|