C30H35N3O4 — CID 25124064
tert-butyl (6R)-6-[5-(5-ethyl-2-pyridinyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoate (PubChem CID 25124064) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is tert-butyl (6R)-6-[5-(5-ethyl-2-pyridinyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoate.
| Compound Name | tert-butyl (6R)-6-[5-(5-ethyl-2-pyridinyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoate |
|---|---|
| PubChem CID | 25124064 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | tert-butyl (6R)-6-[5-(5-ethyl-2-pyridinyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoate |
| SMILES | CCc1ccc(-c2c(-c3ccccc3)oc3ncnc(O[C@H](C)CCCCC(=O)OC(C)(C)C)c23)nc1 |
| InChI | InChI=1S/C30H35N3O4/c1-6-21-16-17-23(31-18-21)25-26-28(35-20(2)12-10-11-15-24(34)37-30(3,4)5)32-19-33-29(26)36-27(25)22-13-8-7-9-14-22/h7-9,13-14,16-20H,6,10-12,15H2,1-5H3/t20-/m1/s1 |
| InChIKey | CPMZKDWMYDYSMV-HXUWFJFHSA-N |
| XLogP | 7.18 |
| TPSA | 87.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|